Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Bis(2,4,6-trichlorophenyl)oxalate, 98%
CAS: 1165-91-9 Molecular Formula: C14H4Cl6O4 Molecular Weight (g/mol): 448.89 MDL Number: MFCD00043061 InChI Key: GEVPIWPYWJZSPR-UHFFFAOYSA-N Synonym: bis 2,4,6-trichlorophenyl oxalate,bis 2,4,6-trichlorophenyl ethanedioate,oxalic acid bis 2,4,6-trichlorophenyl ester,2,4,6-trichlorophenyl oxalate,ethanedioic acid, bis 2,4,6-trichlorophenyl ester,bis-tcpo,acmc-20a7jt,gevpiwpywjzspr-uhfffaoysa PubChem CID: 160567 IUPAC Name: bis(2,4,6-trichlorophenyl) oxalate SMILES: C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl
| PubChem CID | 160567 |
|---|---|
| CAS | 1165-91-9 |
| Molecular Weight (g/mol) | 448.89 |
| MDL Number | MFCD00043061 |
| SMILES | C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl |
| Synonym | bis 2,4,6-trichlorophenyl oxalate,bis 2,4,6-trichlorophenyl ethanedioate,oxalic acid bis 2,4,6-trichlorophenyl ester,2,4,6-trichlorophenyl oxalate,ethanedioic acid, bis 2,4,6-trichlorophenyl ester,bis-tcpo,acmc-20a7jt,gevpiwpywjzspr-uhfffaoysa |
| IUPAC Name | bis(2,4,6-trichlorophenyl) oxalate |
| InChI Key | GEVPIWPYWJZSPR-UHFFFAOYSA-N |
| Molecular Formula | C14H4Cl6O4 |
Calcium Formate, 98%, Pure
CAS: 544-17-2 Molecular Formula: C2H2CaO4 Molecular Weight (g/mol): 130.11 MDL Number: MFCD00036108 InChI Key: CBOCVOKPQGJKKJ-UHFFFAOYSA-L Synonym: calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 PubChem CID: 10997 ChEBI: CHEBI:81851 IUPAC Name: calcium;diformate SMILES: C(=O)[O-].C(=O)[O-].[Ca+2]
| PubChem CID | 10997 |
|---|---|
| CAS | 544-17-2 |
| Molecular Weight (g/mol) | 130.11 |
| ChEBI | CHEBI:81851 |
| MDL Number | MFCD00036108 |
| SMILES | C(=O)[O-].C(=O)[O-].[Ca+2] |
| Synonym | calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 |
| IUPAC Name | calcium;diformate |
| InChI Key | CBOCVOKPQGJKKJ-UHFFFAOYSA-L |
| Molecular Formula | C2H2CaO4 |
2-Amino-5-methylthiazole, 98%
CAS: 7305-71-7 Molecular Formula: C4H6N2S Molecular Weight (g/mol): 114.17 MDL Number: MFCD00078317 InChI Key: GUABFMPMKJGSBQ-UHFFFAOYSA-N Synonym: 2-amino-5-methylthiazole,5-methylthiazol-2-amine,2-thiazolamine, 5-methyl,2-amino-5-methyl-thiazole,thiazole, 2-amino-5-methyl,5-methyl-2-thiazolamine,5-methyl-2-aminothiazole,unii-7rab78af2p,2-amino-5-methyl thiazole,meloxicam related compound b PubChem CID: 351770 IUPAC Name: 5-methyl-1,3-thiazol-2-amine SMILES: CC1=CN=C(S1)N
| PubChem CID | 351770 |
|---|---|
| CAS | 7305-71-7 |
| Molecular Weight (g/mol) | 114.17 |
| MDL Number | MFCD00078317 |
| SMILES | CC1=CN=C(S1)N |
| Synonym | 2-amino-5-methylthiazole,5-methylthiazol-2-amine,2-thiazolamine, 5-methyl,2-amino-5-methyl-thiazole,thiazole, 2-amino-5-methyl,5-methyl-2-thiazolamine,5-methyl-2-aminothiazole,unii-7rab78af2p,2-amino-5-methyl thiazole,meloxicam related compound b |
| IUPAC Name | 5-methyl-1,3-thiazol-2-amine |
| InChI Key | GUABFMPMKJGSBQ-UHFFFAOYSA-N |
| Molecular Formula | C4H6N2S |
Cellulose Acetate Butyrate, Butyryl Content 50-54%
CAS: 9004-36-8 Molecular Formula: (C12H14O10)n MDL Number: MFCD00081513
| CAS | 9004-36-8 |
|---|---|
| MDL Number | MFCD00081513 |
| Molecular Formula | (C12H14O10)n |
Stearic anhydride, 98%
CAS: 638-08-4 Molecular Formula: C36H70O3 Molecular Weight (g/mol): 550.95 MDL Number: MFCD00009004 InChI Key: WVJVHUWVQNLPCR-UHFFFAOYSA-N Synonym: stearic anhydride,octadecanoic acid, anhydride,stearic acid anhydride,stearicanhydride,octadecanoic acid, 1,1'-anhydride,octadecanoic anhydride,e r degrees eeaou,octadecanoic anhydride #,acmc-1b4gn,octadecanoic acid,1,1'-anhydride PubChem CID: 69485 IUPAC Name: octadecanoyl octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCCCCCCCC
| PubChem CID | 69485 |
|---|---|
| CAS | 638-08-4 |
| Molecular Weight (g/mol) | 550.95 |
| MDL Number | MFCD00009004 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCCCCCCCC |
| Synonym | stearic anhydride,octadecanoic acid, anhydride,stearic acid anhydride,stearicanhydride,octadecanoic acid, 1,1'-anhydride,octadecanoic anhydride,e r degrees eeaou,octadecanoic anhydride #,acmc-1b4gn,octadecanoic acid,1,1'-anhydride |
| IUPAC Name | octadecanoyl octadecanoate |
| InChI Key | WVJVHUWVQNLPCR-UHFFFAOYSA-N |
| Molecular Formula | C36H70O3 |
Diphenylamine-4-sulfonic acid, sodium salt, ACS reagent
CAS: 6152-67-6 Molecular Formula: C12H11NNaO3S Molecular Weight (g/mol): 272.27 MDL Number: MFCD00036468 InChI Key: VMVSDVIYIMNZBS-UHFFFAOYSA-N Synonym: sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt PubChem CID: 517002 IUPAC Name: sodium;4-anilinobenzenesulfonate SMILES: [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1
| PubChem CID | 517002 |
|---|---|
| CAS | 6152-67-6 |
| Molecular Weight (g/mol) | 272.27 |
| MDL Number | MFCD00036468 |
| SMILES | [Na].OS(=O)(=O)C1=CC=C(NC2=CC=CC=C2)C=C1 |
| Synonym | sodium 4-phenylamino benzenesulfonate,sodium diphenylamine-4-sulfonate,benzenesulfonic acid, 4-phenylamino-, monosodium salt,unii-3e2ux1382o,sodium 4-anilinobenzenesulfonate,diphenylamine-4-sulfonic acid sodium salt,sodium diphenylamine-p-sulfonate,n-phenylsulfanilic acid, sodium salt,4-phenylamino benzenesulfonic acid sodium salt,diphenylaminesulfonic acid sodium salt |
| IUPAC Name | sodium;4-anilinobenzenesulfonate |
| InChI Key | VMVSDVIYIMNZBS-UHFFFAOYSA-N |
| Molecular Formula | C12H11NNaO3S |
1-Butanesulfonic Acid, Sodium Salt, BAKER™, J.T. Baker™
CAS: 2386-54-1 Molecular Formula: C4H9NaO3S Molecular Weight (g/mol): 160.16 MDL Number: MFCD00007540 InChI Key: XQCHMGAOAWZUPI-UHFFFAOYSA-M Synonym: sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot PubChem CID: 4096517 IUPAC Name: sodium butane-1-sulfonate SMILES: [Na+].CCCCS([O-])(=O)=O
| PubChem CID | 4096517 |
|---|---|
| CAS | 2386-54-1 |
| Molecular Weight (g/mol) | 160.16 |
| MDL Number | MFCD00007540 |
| SMILES | [Na+].CCCCS([O-])(=O)=O |
| Synonym | sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot |
| IUPAC Name | sodium butane-1-sulfonate |
| InChI Key | XQCHMGAOAWZUPI-UHFFFAOYSA-M |
| Molecular Formula | C4H9NaO3S |
tert-Butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate, 97%
CAS: 147804-30-6 Molecular Formula: C11H19NO3 Molecular Weight (g/mol): 213.28 MDL Number: MFCD07779385 InChI Key: ULSBMKGFFFMGOI-UHFFFAOYSA-N Synonym: tert-butyl 1-oxa-6-azaspiro 2.5 octane-6-carboxylate,1-oxa-6-azaspiro 2.5 octane-6-carboxylic acid, 1,1-dimethylethyl ester,6-boc-1-oxa-6-azaspiro 2.5 octane,tert-butyl 1-oxa-6-azaspiro 2,5 octane-6-carboxylate,n-boc-1-oxa-6-azaspiro 2.5 octane,6-n-boc-1-oxa-6-azaspiro 2.5 octane,6-tert-butoxycarbonyl-1-oxa-6-azaspiro 2.5 octane,tert-butyl 2-oxa-6-azaspiro 2.5 octane-6-carboxylate,1-oxa-6-aza-spiro 2.5 octane-6-carboxylic acid tert-butyl ester,tert-butyl 6-azaspiro 2.5 octane-1-oxa-6-carboxylate PubChem CID: 22135564 IUPAC Name: tert-butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate SMILES: CC(C)(C)OC(=O)N1CCC2(CC1)CO2
| PubChem CID | 22135564 |
|---|---|
| CAS | 147804-30-6 |
| Molecular Weight (g/mol) | 213.28 |
| MDL Number | MFCD07779385 |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CO2 |
| Synonym | tert-butyl 1-oxa-6-azaspiro 2.5 octane-6-carboxylate,1-oxa-6-azaspiro 2.5 octane-6-carboxylic acid, 1,1-dimethylethyl ester,6-boc-1-oxa-6-azaspiro 2.5 octane,tert-butyl 1-oxa-6-azaspiro 2,5 octane-6-carboxylate,n-boc-1-oxa-6-azaspiro 2.5 octane,6-n-boc-1-oxa-6-azaspiro 2.5 octane,6-tert-butoxycarbonyl-1-oxa-6-azaspiro 2.5 octane,tert-butyl 2-oxa-6-azaspiro 2.5 octane-6-carboxylate,1-oxa-6-aza-spiro 2.5 octane-6-carboxylic acid tert-butyl ester,tert-butyl 6-azaspiro 2.5 octane-1-oxa-6-carboxylate |
| IUPAC Name | tert-butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate |
| InChI Key | ULSBMKGFFFMGOI-UHFFFAOYSA-N |
| Molecular Formula | C11H19NO3 |
1-Benzylindole-3-carboxylic acid, 98%, Thermo Scientific™
CAS: 27018-76-4 Molecular Formula: C16H13NO2 Molecular Weight (g/mol): 251.28 MDL Number: MFCD00057094 InChI Key: LVYDDRHDOKXFMW-UHFFFAOYSA-N Synonym: 1-benzyl-1h-indole-3-carboxylic acid,indole-3-carboxylic acid, 1-benzyl,1h-indole-3-carboxylic acid, 1-phenylmethyl,pubchem7313,cbmicro_033327,cambridge id 5791025,5-22-03-00037 beilstein handbook reference,1-benzylindol-3-carboxylic acid,n-benzylindole-3-carboxylic acid,1h-indole-3-carboxylicacid, 1-phenylmethyl PubChem CID: 33671 IUPAC Name: 1-benzylindole-3-carboxylic acid SMILES: C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C(=O)O
| PubChem CID | 33671 |
|---|---|
| CAS | 27018-76-4 |
| Molecular Weight (g/mol) | 251.28 |
| MDL Number | MFCD00057094 |
| SMILES | C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C(=O)O |
| Synonym | 1-benzyl-1h-indole-3-carboxylic acid,indole-3-carboxylic acid, 1-benzyl,1h-indole-3-carboxylic acid, 1-phenylmethyl,pubchem7313,cbmicro_033327,cambridge id 5791025,5-22-03-00037 beilstein handbook reference,1-benzylindol-3-carboxylic acid,n-benzylindole-3-carboxylic acid,1h-indole-3-carboxylicacid, 1-phenylmethyl |
| IUPAC Name | 1-benzylindole-3-carboxylic acid |
| InChI Key | LVYDDRHDOKXFMW-UHFFFAOYSA-N |
| Molecular Formula | C16H13NO2 |
3-Aminomethyltetrahydrofuran, 97%
CAS: 165253-31-6 Molecular Formula: C5H11NO Molecular Weight (g/mol): 101.15 MDL Number: MFCD08234925 InChI Key: CINJIXGRSTYIHP-UHFFFAOYSA-N Synonym: tetrahydrofuran-3-yl methanamine,tetrahydro-3-furanmethanamine,tetrahydrofuran-3-ylmethylamine,3-furanmethanamine, tetrahydro,1-tetrahydrofuran-3-ylmethanamine,c-tetrahydro-furan-3-yl-methylamine,3-aminomethyl oxolane,3-aminomethyl tetrahydrofuran,tetrahydrofur-3-yl methylamine,c-tetrahydrofuran-3-yl methylamine PubChem CID: 10898660 IUPAC Name: oxolan-3-ylmethanamine SMILES: C1COCC1CN
| PubChem CID | 10898660 |
|---|---|
| CAS | 165253-31-6 |
| Molecular Weight (g/mol) | 101.15 |
| MDL Number | MFCD08234925 |
| SMILES | C1COCC1CN |
| Synonym | tetrahydrofuran-3-yl methanamine,tetrahydro-3-furanmethanamine,tetrahydrofuran-3-ylmethylamine,3-furanmethanamine, tetrahydro,1-tetrahydrofuran-3-ylmethanamine,c-tetrahydro-furan-3-yl-methylamine,3-aminomethyl oxolane,3-aminomethyl tetrahydrofuran,tetrahydrofur-3-yl methylamine,c-tetrahydrofuran-3-yl methylamine |
| IUPAC Name | oxolan-3-ylmethanamine |
| InChI Key | CINJIXGRSTYIHP-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO |
Methanesulfonic acid, 98%
CAS: 75-75-2 Molecular Formula: CH4O3S Molecular Weight (g/mol): 96.1 InChI Key: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC Name: methanesulfonic acid SMILES: CS(=O)(=O)O
| PubChem CID | 6395 |
|---|---|
| CAS | 75-75-2 |
| Molecular Weight (g/mol) | 96.1 |
| ChEBI | CHEBI:27376 |
| SMILES | CS(=O)(=O)O |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
| IUPAC Name | methanesulfonic acid |
| InChI Key | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
| Molecular Formula | CH4O3S |
N-Hydroxy-2,2-dimethylpropanimidamide, 95%
CAS: 42956-75-2 Molecular Formula: C5H12N2O Molecular Weight (g/mol): 116.16 InChI Key: CVOGFMYWFRFWEQ-UHFFFAOYSA-N Synonym: n-hydroxypivalimidamide,1z-n'-hydroxy-2,2-dimethylpropanimidamide,n-hydroxy-2,2-dimethylpropanimidamide,n-hydroxypivalamidine,z-n'-hydroxy-2,2-dimethylpropanimidamide,hydroxydimethylpropanimidamide,z-n'-hydroxypivalimidamide,z-n'-hydroxy-2,2-dimethylpropimidamide PubChem CID: 9582836 IUPAC Name: N'-hydroxy-2,2-dimethylpropanimidamide SMILES: CC(C)(C)C(=NO)N
| PubChem CID | 9582836 |
|---|---|
| CAS | 42956-75-2 |
| Molecular Weight (g/mol) | 116.16 |
| SMILES | CC(C)(C)C(=NO)N |
| Synonym | n-hydroxypivalimidamide,1z-n'-hydroxy-2,2-dimethylpropanimidamide,n-hydroxy-2,2-dimethylpropanimidamide,n-hydroxypivalamidine,z-n'-hydroxy-2,2-dimethylpropanimidamide,hydroxydimethylpropanimidamide,z-n'-hydroxypivalimidamide,z-n'-hydroxy-2,2-dimethylpropimidamide |
| IUPAC Name | N'-hydroxy-2,2-dimethylpropanimidamide |
| InChI Key | CVOGFMYWFRFWEQ-UHFFFAOYSA-N |
| Molecular Formula | C5H12N2O |
L-Dihydroorotic acid, 99%
CAS: 5988-19-2 Molecular Formula: C5H6N2O4 Molecular Weight (g/mol): 158.11 InChI Key: UFIVEPVSAGBUSI-REOHCLBHSA-N Synonym: l-dihydroorotic acid,s-2,6-dioxohexahydropyrimidine-4-carboxylic acid,l-dihydroorotate,dihydro-l-orotic acid,s-dihydroorotic acid,l-hydroorotic acid,s-dihydroorotate,hydroorotic acid, l,4s-2,6-dioxo-1,3-diazinane-4-carboxylic acid,s-4,5-dihydroorotate PubChem CID: 439216 ChEBI: CHEBI:17025 IUPAC Name: (4S)-2,6-dioxo-1,3-diazinane-4-carboxylic acid SMILES: C1C(NC(=O)NC1=O)C(=O)O
| PubChem CID | 439216 |
|---|---|
| CAS | 5988-19-2 |
| Molecular Weight (g/mol) | 158.11 |
| ChEBI | CHEBI:17025 |
| SMILES | C1C(NC(=O)NC1=O)C(=O)O |
| Synonym | l-dihydroorotic acid,s-2,6-dioxohexahydropyrimidine-4-carboxylic acid,l-dihydroorotate,dihydro-l-orotic acid,s-dihydroorotic acid,l-hydroorotic acid,s-dihydroorotate,hydroorotic acid, l,4s-2,6-dioxo-1,3-diazinane-4-carboxylic acid,s-4,5-dihydroorotate |
| IUPAC Name | (4S)-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| InChI Key | UFIVEPVSAGBUSI-REOHCLBHSA-N |
| Molecular Formula | C5H6N2O4 |
4-Bromo-3-(trifluoromethyl)-1H-pyrazole, 97%, Thermo Scientific™
CAS: 19968-17-3 Molecular Formula: C4H2BrF3N2 Molecular Weight (g/mol): 214.97 InChI Key: JTHNMRUVJDWVMJ-UHFFFAOYSA-N Synonym: 4-bromo-3-trifluoromethyl-1h-pyrazole,4-bromo-5-trifluoromethyl-1h-pyrazole,1h-pyrazole, 4-bromo-3-trifluoromethyl,1h-pyrazole, 4-bromo-5-trifluoromethyl,1h-pyrazole,4-bromo-3-trifluoromethyl,4-bromo-3-trifluoromethyl pyrazole,4-bromo-3-trifluoromethyl-2h-pyrazole,acmc-209f4m,4-bromo-3 trifluoromethyl-1h-pyrazole PubChem CID: 7147398 IUPAC Name: 4-bromo-5-(trifluoromethyl)-1H-pyrazole SMILES: C1=NNC(=C1Br)C(F)(F)F
| PubChem CID | 7147398 |
|---|---|
| CAS | 19968-17-3 |
| Molecular Weight (g/mol) | 214.97 |
| SMILES | C1=NNC(=C1Br)C(F)(F)F |
| Synonym | 4-bromo-3-trifluoromethyl-1h-pyrazole,4-bromo-5-trifluoromethyl-1h-pyrazole,1h-pyrazole, 4-bromo-3-trifluoromethyl,1h-pyrazole, 4-bromo-5-trifluoromethyl,1h-pyrazole,4-bromo-3-trifluoromethyl,4-bromo-3-trifluoromethyl pyrazole,4-bromo-3-trifluoromethyl-2h-pyrazole,acmc-209f4m,4-bromo-3 trifluoromethyl-1h-pyrazole |
| IUPAC Name | 4-bromo-5-(trifluoromethyl)-1H-pyrazole |
| InChI Key | JTHNMRUVJDWVMJ-UHFFFAOYSA-N |
| Molecular Formula | C4H2BrF3N2 |
Tetramethylsilane, ACS reagent, NMR grade
CAS: 75-76-3 Molecular Formula: C4H12Si Molecular Weight (g/mol): 88.23 MDL Number: MFCD00008274 InChI Key: CZDYPVPMEAXLPK-UHFFFAOYSA-N Synonym: silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 PubChem CID: 6396 ChEBI: CHEBI:85361 IUPAC Name: tetramethylsilane SMILES: C[Si](C)(C)C
| PubChem CID | 6396 |
|---|---|
| CAS | 75-76-3 |
| Molecular Weight (g/mol) | 88.23 |
| ChEBI | CHEBI:85361 |
| MDL Number | MFCD00008274 |
| SMILES | C[Si](C)(C)C |
| Synonym | silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 |
| IUPAC Name | tetramethylsilane |
| InChI Key | CZDYPVPMEAXLPK-UHFFFAOYSA-N |
| Molecular Formula | C4H12Si |